C25H50O6Si2 — CID 155725461
(E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoic acid (PubChem CID 155725461) has the molecular formula C25H50O6Si2 and a molecular weight of 502.84 g/mol. Its IUPAC name is (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoic acid |
|---|---|
| PubChem CID | 155725461 |
| Molecular Formula | C25H50O6Si2 |
| Molecular Weight | 502.84 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoic acid |
| SMILES | C[C@H](CC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O6Si2/c1-18(15-13-14-16-22(26)27)28-23-21(31-33(11,12)25(6,7)8)17-20(19(2)29-23)30-32(9,10)24(3,4)5/h14,16,18-21,23H,13,15,17H2,1-12H3,(H,26,27)/b16-14+/t18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | JWVBXXUNTPSVGX-XUAZKPKSSA-N |
| XLogP | 6.73 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.84 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|