C27H54O6Si2 — CID 155725475
ethyl (Z,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 155725475) has the molecular formula C27H54O6Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is ethyl (Z,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | ethyl (Z,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 155725475 |
| Molecular Formula | C27H54O6Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | ethyl (Z,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C\CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O6Si2/c1-14-29-24(28)18-16-15-17-20(2)30-25-23(33-35(12,13)27(7,8)9)19-22(21(3)31-25)32-34(10,11)26(4,5)6/h16,18,20-23,25H,14-15,17,19H2,1-13H3/b18-16-/t20-,21+,22-,23-,25-/m1/s1 |
| InChIKey | QHMIXUNRQLQQLJ-BABCRQEFSA-N |
| XLogP | 7.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|