About propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate
propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 155725500) has the molecular formula C16H28O5
and a molecular weight of 300.40 g/mol. Its IUPAC name is propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| PubChem CID | 155725500 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | CC(C)OC(=O)/C=C/CC[C@@H](C)OC1O[C@@H](C)CCC1O |
| InChI | InChI=1S/C16H28O5/c1-11(2)19-15(18)8-6-5-7-12(3)20-16-14(17)10-9-13(4)21-16/h6,8,11-14,16-17H,5,7,9-10H2,1-4H3/b8-6+/t12-,13+,14?,16?/m1/s1 |
| InChIKey | SVYDQOPSIWOQIS-BCKDEBIQSA-N |
| XLogP | 2.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate?
The IUPAC name of propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (CID 155725500) is propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
What is the SMILES notation for propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate?
The canonical SMILES for propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate is CC(C)OC(=O)/C=C/CC[C@@H](C)OC1O[C@@H](C)CCC1O.
What is the InChIKey of propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate?
The InChIKey is SVYDQOPSIWOQIS-BCKDEBIQSA-N. The full InChI is InChI=1S/C16H28O5/c1-11(2)19-15(18)8-6-5-7-12(3)20-16-14(17)10-9-13(4)21-16/h6,8,11-14,16-17H,5,7,9-10H2,1-4H3/b8-6+/t12-,13+,14?,16?/m1/s1.
What are the key properties of propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate?
propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate has a molecular weight of 300.40 g/mol, XLogP of 2.57, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E,6R)-6-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate is sourced from PubChem (CID 155725500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).