About CID 155726397
CID 155726397 (PubChem CID 155726397) has the molecular formula C34H49FN7O3
and a molecular weight of 622.81 g/mol.
Molecular Properties
| Compound Name | CID 155726397 |
| PubChem CID | 155726397 |
| Molecular Formula | C34H49FN7O3 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN(C2=NC(OCC)=NC(C[C@@H]3Cc4c(F)cccc4N(C)C3=O)[C]2CC)CC1.CCC#N.CN1CCCC1 |
| InChI | InChI=1S/C26H33FN5O3.C5H11N.C3H5N/c1-5-18-21(16-17-15-19-20(27)9-8-10-22(19)30(4)25(17)34)28-26(35-7-3)29-24(18)32-13-11-31(12-14-32)23(33)6-2;1-6-4-2-3-5-6;1-2-3-4/h6,8-10,17,21H,2,5,7,11-16H2,1,3-4H3;2-5H2,1H3;2H2,1H3/t17-,21?;;/m0../s1 |
| InChIKey | ISHKZQWZCNAZTR-BTXBZZIISA-N |
| XLogP | 4.47 |
| TPSA | 104.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 155726397 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155726397?
The IUPAC name of CID 155726397 (CID 155726397) is not available.
What is the SMILES notation for CID 155726397?
The canonical SMILES for CID 155726397 is C=CC(=O)N1CCN(C2=NC(OCC)=NC(C[C@@H]3Cc4c(F)cccc4N(C)C3=O)[C]2CC)CC1.CCC#N.CN1CCCC1.
What is the InChIKey of CID 155726397?
The InChIKey is ISHKZQWZCNAZTR-BTXBZZIISA-N. The full InChI is InChI=1S/C26H33FN5O3.C5H11N.C3H5N/c1-5-18-21(16-17-15-19-20(27)9-8-10-22(19)30(4)25(17)34)28-26(35-7-3)29-24(18)32-13-11-31(12-14-32)23(33)6-2;1-6-4-2-3-5-6;1-2-3-4/h6,8-10,17,21H,2,5,7,11-16H2,1,3-4H3;2-5H2,1H3;2H2,1H3/t17-,21?;;/m0../s1.
What are the key properties of CID 155726397?
CID 155726397 has a molecular weight of 622.81 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155726397 is sourced from PubChem (CID 155726397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).