C11H10N2O2S — CID 15572732
spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 15572732) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 15572732 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CCSc3ccccc32)N1 |
| InChI | InChI=1S/C11H10N2O2S/c14-9-11(13-10(15)12-9)5-6-16-8-4-2-1-3-7(8)11/h1-4H,5-6H2,(H2,12,13,14,15) |
| InChIKey | GPXJCNBTUQIPOM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|