C12H12N2O3S — CID 15572733
6-methoxyspiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 15572733) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 6-methoxyspiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-methoxyspiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 15572733 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 6-methoxyspiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)C1(CCS2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O3S/c1-17-7-2-3-9-8(6-7)12(4-5-18-9)10(15)13-11(16)14-12/h2-3,6H,4-5H2,1H3,(H2,13,14,15,16) |
| InChIKey | IQWSXVQEGJONIU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|