C13H14N2O3 — CID 15572756
6,8-dimethylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 15572756) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 6,8-dimethylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6,8-dimethylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 15572756 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6,8-dimethylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C)c2c(c1)C1(CCO2)NC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O3/c1-7-5-8(2)10-9(6-7)13(3-4-18-10)11(16)14-12(17)15-13/h5-6H,3-4H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | BYFIQXGIDZTPHX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|