C23H25FN4O2 — CID 155728631
6-(5-fluoro-2-pyridinyl)-8-methoxy-N-[(Z)-2-[(Z)-2-methoxyprop-1-enyl]pent-2-enyl]quinazolin-4-amine (PubChem CID 155728631) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 6-(5-fluoro-2-pyridinyl)-8-methoxy-N-[(Z)-2-[(Z)-2-methoxyprop-1-enyl]pent-2-enyl]quinazolin-4-amine.
| Compound Name | 6-(5-fluoro-2-pyridinyl)-8-methoxy-N-[(Z)-2-[(Z)-2-methoxyprop-1-enyl]pent-2-enyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 155728631 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 6-(5-fluoro-2-pyridinyl)-8-methoxy-N-[(Z)-2-[(Z)-2-methoxyprop-1-enyl]pent-2-enyl]quinazolin-4-amine |
| SMILES | CC/C=C(/C=C(/C)OC)CNc1ncnc2c(OC)cc(-c3ccc(F)cn3)cc12 |
| InChI | InChI=1S/C23H25FN4O2/c1-5-6-16(9-15(2)29-3)12-26-23-19-10-17(20-8-7-18(24)13-25-20)11-21(30-4)22(19)27-14-28-23/h6-11,13-14H,5,12H2,1-4H3,(H,26,27,28)/b15-9-,16-6- |
| InChIKey | YKTOSPVCULOPJL-LUEYETGZSA-N |
| XLogP | 5.14 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|