C13H21FN2 — CID 155728810
N'-[(2Z,3Z,5E)-5-fluoro-3-methyl-2-propylidenehepta-3,5-dienyl]ethanimidamide (PubChem CID 155728810) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N'-[(2Z,3Z,5E)-5-fluoro-3-methyl-2-propylidenehepta-3,5-dienyl]ethanimidamide.
| Compound Name | N'-[(2Z,3Z,5E)-5-fluoro-3-methyl-2-propylidenehepta-3,5-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 155728810 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N'-[(2Z,3Z,5E)-5-fluoro-3-methyl-2-propylidenehepta-3,5-dienyl]ethanimidamide |
| SMILES | C/C=C(F)\C=C(C)/C(=C/CC)C/N=C(\C)N |
| InChI | InChI=1S/C13H21FN2/c1-5-7-12(9-16-11(4)15)10(3)8-13(14)6-2/h6-8H,5,9H2,1-4H3,(H2,15,16)/b10-8-,12-7+,13-6+ |
| InChIKey | XDVAIYBWJQQSJG-NQBSRSBCSA-N |
| XLogP | 3.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|