About ethane;3-hydroxy-1,3-dimethylpiperidin-2-one
ethane;3-hydroxy-1,3-dimethylpiperidin-2-one (PubChem CID 155729071) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethane;3-hydroxy-1,3-dimethylpiperidin-2-one.
Molecular Properties
| Compound Name | ethane;3-hydroxy-1,3-dimethylpiperidin-2-one |
| PubChem CID | 155729071 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | ethane;3-hydroxy-1,3-dimethylpiperidin-2-one |
| SMILES | CC.CN1CCCC(C)(O)C1=O |
| InChI | InChI=1S/C7H13NO2.C2H6/c1-7(10)4-3-5-8(2)6(7)9;1-2/h10H,3-5H2,1-2H3;1-2H3 |
| InChIKey | GFCVZGGDRJOGIQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-hydroxy-1,3-dimethylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-hydroxy-1,3-dimethylpiperidin-2-one?
The IUPAC name of ethane;3-hydroxy-1,3-dimethylpiperidin-2-one (CID 155729071) is ethane;3-hydroxy-1,3-dimethylpiperidin-2-one.
What is the SMILES notation for ethane;3-hydroxy-1,3-dimethylpiperidin-2-one?
The canonical SMILES for ethane;3-hydroxy-1,3-dimethylpiperidin-2-one is CC.CN1CCCC(C)(O)C1=O.
What is the InChIKey of ethane;3-hydroxy-1,3-dimethylpiperidin-2-one?
The InChIKey is GFCVZGGDRJOGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C2H6/c1-7(10)4-3-5-8(2)6(7)9;1-2/h10H,3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;3-hydroxy-1,3-dimethylpiperidin-2-one?
ethane;3-hydroxy-1,3-dimethylpiperidin-2-one has a molecular weight of 173.26 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-hydroxy-1,3-dimethylpiperidin-2-one is sourced from PubChem (CID 155729071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).