C12H14ClF3N2O4 — CID 155729107
tert-butyl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate (PubChem CID 155729107) has the molecular formula C12H14ClF3N2O4 and a molecular weight of 342.70 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 155729107 |
| Molecular Formula | C12H14ClF3N2O4 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | tert-butyl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(C(O)(O)C(F)(F)F)ccnc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O4/c1-10(2,3)22-9(19)18-7-6(4-5-17-8(7)13)11(20,21)12(14,15)16/h4-5,20-21H,1-3H3,(H,18,19) |
| InChIKey | KFURVOPCCFERLA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|