About [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate
[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate (PubChem CID 155729257) has the molecular formula C20H34N2O5
and a molecular weight of 382.50 g/mol. Its IUPAC name is [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate.
Molecular Properties
| Compound Name | [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate |
| PubChem CID | 155729257 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate |
| SMILES | CCCCCC1=NN(C(=O)CCOC(=O)CCC=O)OC(CCCCC)C1 |
| InChI | InChI=1S/C20H34N2O5/c1-3-5-7-10-17-16-18(11-8-6-4-2)27-22(21-17)19(24)13-15-26-20(25)12-9-14-23/h14,18H,3-13,15-16H2,1-2H3 |
| InChIKey | DJNVMADIMCITRN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate?
The IUPAC name of [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate (CID 155729257) is [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate.
What is the SMILES notation for [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate?
The canonical SMILES for [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate is CCCCCC1=NN(C(=O)CCOC(=O)CCC=O)OC(CCCCC)C1.
What is the InChIKey of [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate?
The InChIKey is DJNVMADIMCITRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O5/c1-3-5-7-10-17-16-18(11-8-6-4-2)27-22(21-17)19(24)13-15-26-20(25)12-9-14-23/h14,18H,3-13,15-16H2,1-2H3.
What are the key properties of [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate?
[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate has a molecular weight of 382.50 g/mol, XLogP of 3.95, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] 4-oxobutanoate is sourced from PubChem (CID 155729257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).