C14H20N2O — CID 15572948
2,3,6-trimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one (PubChem CID 15572948) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2,3,6-trimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one.
| Compound Name | 2,3,6-trimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
|---|---|
| PubChem CID | 15572948 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2,3,6-trimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
| SMILES | Cc1[nH]c2c(c1C)C(=O)C1CN(C)CCC1C2 |
| InChI | InChI=1S/C14H20N2O/c1-8-9(2)15-12-6-10-4-5-16(3)7-11(10)14(17)13(8)12/h10-11,15H,4-7H2,1-3H3 |
| InChIKey | KBUWLDZFMSKMLE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |