C28H34F3N7O4 — CID 155729811
2,2-difluoroethyl (3Z)-6-[[5-fluoro-2-[formyl(oxetan-3-yl)amino]-N-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]methyl]-N-methylidenepyridine-3-carbohydrazonate (PubChem CID 155729811) has the molecular formula C28H34F3N7O4 and a molecular weight of 589.62 g/mol. Its IUPAC name is 2,2-difluoroethyl (3Z)-6-[[5-fluoro-2-[formyl(oxetan-3-yl)amino]-N-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]methyl]-N-methylidenepyridine-3-carbohydrazonate.
| Compound Name | 2,2-difluoroethyl (3Z)-6-[[5-fluoro-2-[formyl(oxetan-3-yl)amino]-N-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]methyl]-N-methylidenepyridine-3-carbohydrazonate |
|---|---|
| PubChem CID | 155729811 |
| Molecular Formula | C28H34F3N7O4 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 2,2-difluoroethyl (3Z)-6-[[5-fluoro-2-[formyl(oxetan-3-yl)amino]-N-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]methyl]-N-methylidenepyridine-3-carbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(C)c2cc(F)c(N3CCN(C4COC4)CC3)cc2N(C=O)C2COC2)nc1 |
| InChI | InChI=1S/C28H34F3N7O4/c1-32-34-28(42-17-27(30)31)19-3-4-20(33-11-19)12-35(2)25-9-23(29)24(10-26(25)38(18-39)22-15-41-16-22)37-7-5-36(6-8-37)21-13-40-14-21/h3-4,9-11,18,21-22,27H,1,5-8,12-17H2,2H3/b34-28- |
| InChIKey | BCKIPLCRQXBQML-BFYITVNDSA-N |
| XLogP | 2.38 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|