About [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol
[2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 15573) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 15573 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(c2ccco2)O1 |
| InChI | InChI=1S/C8H10O4/c9-4-6-5-11-8(12-6)7-2-1-3-10-7/h1-3,6,8-9H,4-5H2 |
| InChIKey | BKRXMKVDYAWYHS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol (CID 15573) is [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol is OCC1COC(c2ccco2)O1.
What is the InChIKey of [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is BKRXMKVDYAWYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c9-4-6-5-11-8(12-6)7-2-1-3-10-7/h1-3,6,8-9H,4-5H2.
What are the key properties of [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol?
[2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 170.16 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 15573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).