C26H26F2N6O5S — CID 155730192
2-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-4,4-dimethyl-6-[(1-methylsulfonyl-3,6-dihydro-2H-pyridin-3-yl)amino]isoquinoline-1,3-dione (PubChem CID 155730192) has the molecular formula C26H26F2N6O5S and a molecular weight of 572.59 g/mol. Its IUPAC name is 2-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-4,4-dimethyl-6-[(1-methylsulfonyl-3,6-dihydro-2H-pyridin-3-yl)amino]isoquinoline-1,3-dione.
| Compound Name | 2-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-4,4-dimethyl-6-[(1-methylsulfonyl-3,6-dihydro-2H-pyridin-3-yl)amino]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 155730192 |
| Molecular Formula | C26H26F2N6O5S |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-4,4-dimethyl-6-[(1-methylsulfonyl-3,6-dihydro-2H-pyridin-3-yl)amino]isoquinoline-1,3-dione |
| SMILES | CC1(C)C(=O)N(Cc2ccc(-c3nnc(C(F)F)o3)cn2)C(=O)c2ccc(NC3C=CCN(S(C)(=O)=O)C3)cc21 |
| InChI | InChI=1S/C26H26F2N6O5S/c1-26(2)20-11-16(30-18-5-4-10-33(13-18)40(3,37)38)8-9-19(20)24(35)34(25(26)36)14-17-7-6-15(12-29-17)22-31-32-23(39-22)21(27)28/h4-9,11-12,18,21,30H,10,13-14H2,1-3H3 |
| InChIKey | JMPCDYOSQNSVEN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|