C19H19F3N6O4S — CID 155730404
4-[1-[6-(4-ethylsulfonyl-1,1,1-trifluorobutan-2-yl)-2-pyridinyl]pyrazol-4-yl]-3-nitropyridin-2-amine (PubChem CID 155730404) has the molecular formula C19H19F3N6O4S and a molecular weight of 484.46 g/mol. Its IUPAC name is 4-[1-[6-(4-ethylsulfonyl-1,1,1-trifluorobutan-2-yl)-2-pyridinyl]pyrazol-4-yl]-3-nitropyridin-2-amine.
| Compound Name | 4-[1-[6-(4-ethylsulfonyl-1,1,1-trifluorobutan-2-yl)-2-pyridinyl]pyrazol-4-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 155730404 |
| Molecular Formula | C19H19F3N6O4S |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-[1-[6-(4-ethylsulfonyl-1,1,1-trifluorobutan-2-yl)-2-pyridinyl]pyrazol-4-yl]-3-nitropyridin-2-amine |
| SMILES | CCS(=O)(=O)CCC(c1cccc(-n2cc(-c3ccnc(N)c3[N+](=O)[O-])cn2)n1)C(F)(F)F |
| InChI | InChI=1S/C19H19F3N6O4S/c1-2-33(31,32)9-7-14(19(20,21)22)15-4-3-5-16(26-15)27-11-12(10-25-27)13-6-8-24-18(23)17(13)28(29)30/h3-6,8,10-11,14H,2,7,9H2,1H3,(H2,23,24) |
| InChIKey | OECMWPFXOWJOFG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|