C17H27F3OS — CID 155730440
(4E,6Z)-8-methylidene-5-(1,1,1-trifluoro-4-methylsulfinylbutan-2-yl)undeca-4,6-diene (PubChem CID 155730440) has the molecular formula C17H27F3OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (4E,6Z)-8-methylidene-5-(1,1,1-trifluoro-4-methylsulfinylbutan-2-yl)undeca-4,6-diene.
| Compound Name | (4E,6Z)-8-methylidene-5-(1,1,1-trifluoro-4-methylsulfinylbutan-2-yl)undeca-4,6-diene |
|---|---|
| PubChem CID | 155730440 |
| Molecular Formula | C17H27F3OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (4E,6Z)-8-methylidene-5-(1,1,1-trifluoro-4-methylsulfinylbutan-2-yl)undeca-4,6-diene |
| SMILES | C=C(/C=C\C(=C/CCC)C(CCS(C)=O)C(F)(F)F)CCC |
| InChI | InChI=1S/C17H27F3OS/c1-5-7-9-15(11-10-14(3)8-6-2)16(17(18,19)20)12-13-22(4)21/h9-11,16H,3,5-8,12-13H2,1-2,4H3/b11-10-,15-9+ |
| InChIKey | HDVJJSZVZRPWHB-XDOJEHJTSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|