C10H15F3N4O — CID 155730485
ethane;1-(5-methylpyrimidin-2-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 155730485) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is ethane;1-(5-methylpyrimidin-2-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | ethane;1-(5-methylpyrimidin-2-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 155730485 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethane;1-(5-methylpyrimidin-2-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC.Cc1cnc(NC(=O)NCC(F)(F)F)nc1 |
| InChI | InChI=1S/C8H9F3N4O.C2H6/c1-5-2-12-6(13-3-5)15-7(16)14-4-8(9,10)11;1-2/h2-3H,4H2,1H3,(H2,12,13,14,15,16);1-2H3 |
| InChIKey | YKBYNQQUSKZXRJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |