C15H11F3N4O3S — CID 155730508
5-ethylsulfonyl-2-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carbaldehyde (PubChem CID 155730508) has the molecular formula C15H11F3N4O3S and a molecular weight of 384.34 g/mol. Its IUPAC name is 5-ethylsulfonyl-2-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carbaldehyde.
| Compound Name | 5-ethylsulfonyl-2-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 155730508 |
| Molecular Formula | C15H11F3N4O3S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 5-ethylsulfonyl-2-[7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carbaldehyde |
| SMILES | CCS(=O)(=O)c1cnc(-c2nc3cc(C(F)(F)F)ccn3n2)c(C=O)c1 |
| InChI | InChI=1S/C15H11F3N4O3S/c1-2-26(24,25)11-5-9(8-23)13(19-7-11)14-20-12-6-10(15(16,17)18)3-4-22(12)21-14/h3-8H,2H2,1H3 |
| InChIKey | OYEYXDGJZVQESD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|