9H-pyrido[3,4-b]indole-1-carboxylic acid

C12H8N2O2 — CID 15573079

IUPAC9H-pyrido[3,4-b]indole-1-carboxylic acid
SMILESO=C(O)c1nccc2c1[nH]c1ccccc12
InChIInChI=1S/C12H8N2O2/c15-12(16)11-10-8(5-6-13-11)7-3-1-2-4-9(7)14-10/h1-6,14H,(H,15,16)
InChIKeyVNPNEGORDFERGK-UHFFFAOYSA-N
MW212.21 g/mol
LogP2.41
Rot. Bonds1

About 9H-pyrido[3,4-b]indole-1-carboxylic acid

9H-pyrido[3,4-b]indole-1-carboxylic acid (PubChem CID 15573079) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 9H-pyrido[3,4-b]indole-1-carboxylic acid.

Molecular Properties

Compound Name9H-pyrido[3,4-b]indole-1-carboxylic acid
PubChem CID15573079
Molecular FormulaC12H8N2O2
Molecular Weight212.21 g/mol
Exact Mass212.06
IUPAC Name9H-pyrido[3,4-b]indole-1-carboxylic acid
SMILESO=C(O)c1nccc2c1[nH]c1ccccc12
InChIInChI=1S/C12H8N2O2/c15-12(16)11-10-8(5-6-13-11)7-3-1-2-4-9(7)14-10/h1-6,14H,(H,15,16)
InChIKeyVNPNEGORDFERGK-UHFFFAOYSA-N
XLogP2.41
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.21
LogP ≤ 52.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 9H-pyrido[3,4-b]indole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-pyrido[3,4-b]indole-1-carboxylic acid?
The IUPAC name of 9H-pyrido[3,4-b]indole-1-carboxylic acid (CID 15573079) is 9H-pyrido[3,4-b]indole-1-carboxylic acid.
What is the SMILES notation for 9H-pyrido[3,4-b]indole-1-carboxylic acid?
The canonical SMILES for 9H-pyrido[3,4-b]indole-1-carboxylic acid is O=C(O)c1nccc2c1[nH]c1ccccc12.
What is the InChIKey of 9H-pyrido[3,4-b]indole-1-carboxylic acid?
The InChIKey is VNPNEGORDFERGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12(16)11-10-8(5-6-13-11)7-3-1-2-4-9(7)14-10/h1-6,14H,(H,15,16).
What are the key properties of 9H-pyrido[3,4-b]indole-1-carboxylic acid?
9H-pyrido[3,4-b]indole-1-carboxylic acid has a molecular weight of 212.21 g/mol, XLogP of 2.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrido[3,4-b]indole-1-carboxylic acid is sourced from PubChem (CID 15573079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).