C34H22Cl4N8S2 — CID 15573094
8-chloro-1-[[[8-chloro-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methyldisulfanyl]methyl]-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 15573094) has the molecular formula C34H22Cl4N8S2 and a molecular weight of 748.55 g/mol. Its IUPAC name is 8-chloro-1-[[[8-chloro-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methyldisulfanyl]methyl]-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[[[8-chloro-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methyldisulfanyl]methyl]-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 15573094 |
| Molecular Formula | C34H22Cl4N8S2 |
| Molecular Weight | 748.55 g/mol |
| Exact Mass | 746.02 |
| IUPAC Name | 8-chloro-1-[[[8-chloro-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methyldisulfanyl]methyl]-6-(2-chlorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)C(c1ccccc1Cl)=NCc1nnc(CSSCc3nnc4n3-c3ccc(Cl)cc3C(c3ccccc3Cl)=NC4)n1-2 |
| InChI | InChI=1S/C34H22Cl4N8S2/c35-19-9-11-27-23(13-19)33(21-5-1-3-7-25(21)37)39-15-29-41-43-31(45(27)29)17-47-48-18-32-44-42-30-16-40-34(22-6-2-4-8-26(22)38)24-14-20(36)10-12-28(24)46(30)32/h1-14H,15-18H2 |
| InChIKey | ZMNTWDJRXZORGJ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.55 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|