C32H44N4O — CID 155731250
ethane;4-[(2Z,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-1-[(2Z,3Z,5E)-6-methyl-2-(1-pyrimidin-4-ylethylidene)octa-3,5-dienoyl]piperidine-4-carbonitrile (PubChem CID 155731250) has the molecular formula C32H44N4O and a molecular weight of 500.73 g/mol. Its IUPAC name is ethane;4-[(2Z,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-1-[(2Z,3Z,5E)-6-methyl-2-(1-pyrimidin-4-ylethylidene)octa-3,5-dienoyl]piperidine-4-carbonitrile.
| Compound Name | ethane;4-[(2Z,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-1-[(2Z,3Z,5E)-6-methyl-2-(1-pyrimidin-4-ylethylidene)octa-3,5-dienoyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 155731250 |
| Molecular Formula | C32H44N4O |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | ethane;4-[(2Z,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-1-[(2Z,3Z,5E)-6-methyl-2-(1-pyrimidin-4-ylethylidene)octa-3,5-dienoyl]piperidine-4-carbonitrile |
| SMILES | C=C(C)/C=C\C(=C/C)CC1(C#N)CCN(C(=O)C(/C=C\C=C(/C)CC)=C(/C)c2ccncn2)CC1.CC |
| InChI | InChI=1S/C30H38N4O.C2H6/c1-7-24(5)10-9-11-27(25(6)28-14-17-32-22-33-28)29(35)34-18-15-30(21-31,16-19-34)20-26(8-2)13-12-23(3)4;1-2/h8-14,17,22H,3,7,15-16,18-20H2,1-2,4-6H3;1-2H3/b11-9-,13-12-,24-10+,26-8+,27-25-; |
| InChIKey | LMVZTYXHQPYDIR-AGBOVZMASA-N |
| XLogP | 7.79 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|