C16H20BF3O4 — CID 155731398
ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate (PubChem CID 155731398) has the molecular formula C16H20BF3O4 and a molecular weight of 344.14 g/mol. Its IUPAC name is ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate.
| Compound Name | ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 155731398 |
| Molecular Formula | C16H20BF3O4 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H20BF3O4/c1-6-22-13(21)11-9-10(16(18,19)20)7-8-12(11)17-23-14(2,3)15(4,5)24-17/h7-9H,6H2,1-5H3 |
| InChIKey | FTZZFCUSOHWPMY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|