C29H38FNO4 — CID 155731654
(2E,4Z)-4-acetyl-N,N-diethyl-2-[5-[(3-fluoro-4-hydroxyphenyl)methoxy]-2-methylphenyl]hepta-2,4-dienamide;ethane (PubChem CID 155731654) has the molecular formula C29H38FNO4 and a molecular weight of 483.62 g/mol. Its IUPAC name is (2E,4Z)-4-acetyl-N,N-diethyl-2-[5-[(3-fluoro-4-hydroxyphenyl)methoxy]-2-methylphenyl]hepta-2,4-dienamide;ethane.
| Compound Name | (2E,4Z)-4-acetyl-N,N-diethyl-2-[5-[(3-fluoro-4-hydroxyphenyl)methoxy]-2-methylphenyl]hepta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 155731654 |
| Molecular Formula | C29H38FNO4 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2E,4Z)-4-acetyl-N,N-diethyl-2-[5-[(3-fluoro-4-hydroxyphenyl)methoxy]-2-methylphenyl]hepta-2,4-dienamide;ethane |
| SMILES | CC.CC/C=C(/C=C(/C(=O)N(CC)CC)c1cc(OCc2ccc(O)c(F)c2)ccc1C)C(C)=O |
| InChI | InChI=1S/C27H32FNO4.C2H6/c1-6-9-21(19(5)30)15-24(27(32)29(7-2)8-3)23-16-22(12-10-18(23)4)33-17-20-11-13-26(31)25(28)14-20;1-2/h9-16,31H,6-8,17H2,1-5H3;1-2H3/b21-9-,24-15+; |
| InChIKey | JBUBTRQQROWSRT-LKTLXXHXSA-N |
| XLogP | 6.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|