C24H21F2N5O3S2 — CID 155732321
7-[4-amino-3-(methyliminomethyl)phenyl]-5-[4-[bis(sulfanyl)methoxy]phenyl]-3-(2,2-difluoroethoxy)pyrido[2,3-b]pyrazin-6-one (PubChem CID 155732321) has the molecular formula C24H21F2N5O3S2 and a molecular weight of 529.59 g/mol. Its IUPAC name is 7-[4-amino-3-(methyliminomethyl)phenyl]-5-[4-[bis(sulfanyl)methoxy]phenyl]-3-(2,2-difluoroethoxy)pyrido[2,3-b]pyrazin-6-one.
| Compound Name | 7-[4-amino-3-(methyliminomethyl)phenyl]-5-[4-[bis(sulfanyl)methoxy]phenyl]-3-(2,2-difluoroethoxy)pyrido[2,3-b]pyrazin-6-one |
|---|---|
| PubChem CID | 155732321 |
| Molecular Formula | C24H21F2N5O3S2 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 7-[4-amino-3-(methyliminomethyl)phenyl]-5-[4-[bis(sulfanyl)methoxy]phenyl]-3-(2,2-difluoroethoxy)pyrido[2,3-b]pyrazin-6-one |
| SMILES | C/N=C/c1cc(-c2cc3ncc(OCC(F)F)nc3n(-c3ccc(OC(S)S)cc3)c2=O)ccc1N |
| InChI | InChI=1S/C24H21F2N5O3S2/c1-28-10-14-8-13(2-7-18(14)27)17-9-19-22(30-21(11-29-19)33-12-20(25)26)31(23(17)32)15-3-5-16(6-4-15)34-24(35)36/h2-11,20,24,35-36H,12,27H2,1H3/b28-10+ |
| InChIKey | YIJONDZNNRFGAU-ORBVJSQLSA-N |
| XLogP | 4.24 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|