C30H32F3N7O3Si — CID 155732367
6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 155732367) has the molecular formula C30H32F3N7O3Si and a molecular weight of 623.71 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155732367 |
| Molecular Formula | C30H32F3N7O3Si |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccc(-c2cc3cnc(NCC(F)(F)F)nc3n(-c3ccc(-c4ncn(COCC[Si](C)(C)C)n4)cc3)c2=O)cc1 |
| InChI | InChI=1S/C30H32F3N7O3Si/c1-42-24-11-7-20(8-12-24)25-15-22-16-34-29(35-17-30(31,32)33)37-27(22)40(28(25)41)23-9-5-21(6-10-23)26-36-18-39(38-26)19-43-13-14-44(2,3)4/h5-12,15-16,18H,13-14,17,19H2,1-4H3,(H,34,35,37) |
| InChIKey | ISPMIYHXGBMBPO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|