About ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate
ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate (PubChem CID 155732612) has the molecular formula C17H22N2O4S
and a molecular weight of 350.44 g/mol. Its IUPAC name is ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate |
| PubChem CID | 155732612 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NC)ccc1NCC1=CCCC=C1 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-23-17(20)15-11-14(24(21,22)18-2)9-10-16(15)19-12-13-7-5-4-6-8-13/h5,7-11,18-19H,3-4,6,12H2,1-2H3 |
| InChIKey | RYEQWKXGMIMTLP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate?
The IUPAC name of ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate (CID 155732612) is ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate.
What is the SMILES notation for ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate?
The canonical SMILES for ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate is CCOC(=O)c1cc(S(=O)(=O)NC)ccc1NCC1=CCCC=C1.
What is the InChIKey of ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate?
The InChIKey is RYEQWKXGMIMTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4S/c1-3-23-17(20)15-11-14(24(21,22)18-2)9-10-16(15)19-12-13-7-5-4-6-8-13/h5,7-11,18-19H,3-4,6,12H2,1-2H3.
What are the key properties of ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate?
ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate has a molecular weight of 350.44 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(cyclohexa-1,5-dien-1-ylmethylamino)-5-(methylsulfamoyl)benzoate is sourced from PubChem (CID 155732612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).