C25H44O — CID 155733232
methanol;3,5,13,15-tetramethyl-17-prop-1-en-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 155733232) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is methanol;3,5,13,15-tetramethyl-17-prop-1-en-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | methanol;3,5,13,15-tetramethyl-17-prop-1-en-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 155733232 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | methanol;3,5,13,15-tetramethyl-17-prop-1-en-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(C)C1CC(C)C2C3CCC4(C)CC(C)CCC4C3CCC12C.CO |
| InChI | InChI=1S/C24H40.CH4O/c1-15(2)21-13-17(4)22-19-9-11-23(5)14-16(3)7-8-20(23)18(19)10-12-24(21,22)6;1-2/h16-22H,1,7-14H2,2-6H3;2H,1H3 |
| InChIKey | JOYDHDXVRJVXPE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|