About CID 155734743
CID 155734743 (PubChem CID 155734743) has the molecular formula C27H21BFN3O3
and a molecular weight of 465.29 g/mol.
Molecular Properties
| Compound Name | CID 155734743 |
| PubChem CID | 155734743 |
| Molecular Formula | C27H21BFN3O3 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | — |
| SMILES | [B]c1[nH]nc2cc3c(-c4ccc(C(=O)O)cc4)c(C4CCOCC4)n(-c4ccc(F)cc4)c3cc12 |
| InChI | InChI=1S/C27H21BFN3O3/c28-26-20-14-23-21(13-22(20)30-31-26)24(15-1-3-17(4-2-15)27(33)34)25(16-9-11-35-12-10-16)32(23)19-7-5-18(29)6-8-19/h1-8,13-14,16H,9-12H2,(H,30,31)(H,33,34) |
| InChIKey | BEUWATDMSKCRJV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155734743 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155734743?
The IUPAC name of CID 155734743 (CID 155734743) is not available.
What is the SMILES notation for CID 155734743?
The canonical SMILES for CID 155734743 is [B]c1[nH]nc2cc3c(-c4ccc(C(=O)O)cc4)c(C4CCOCC4)n(-c4ccc(F)cc4)c3cc12.
What is the InChIKey of CID 155734743?
The InChIKey is BEUWATDMSKCRJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21BFN3O3/c28-26-20-14-23-21(13-22(20)30-31-26)24(15-1-3-17(4-2-15)27(33)34)25(16-9-11-35-12-10-16)32(23)19-7-5-18(29)6-8-19/h1-8,13-14,16H,9-12H2,(H,30,31)(H,33,34).
What are the key properties of CID 155734743?
CID 155734743 has a molecular weight of 465.29 g/mol, XLogP of 4.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155734743 is sourced from PubChem (CID 155734743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).