C18H38N2O4 — CID 155734916
ethane;N-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-2-(2-methylprop-2-enylamino)acetamide (PubChem CID 155734916) has the molecular formula C18H38N2O4 and a molecular weight of 346.51 g/mol. Its IUPAC name is ethane;N-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-2-(2-methylprop-2-enylamino)acetamide.
| Compound Name | ethane;N-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-2-(2-methylprop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 155734916 |
| Molecular Formula | C18H38N2O4 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | ethane;N-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-2-(2-methylprop-2-enylamino)acetamide |
| SMILES | C=C(C)CNCC(=O)NCCOC1O[C@@H](C)CCC1O.CC.CC |
| InChI | InChI=1S/C14H26N2O4.2C2H6/c1-10(2)8-15-9-13(18)16-6-7-19-14-12(17)5-4-11(3)20-14;2*1-2/h11-12,14-15,17H,1,4-9H2,2-3H3,(H,16,18);2*1-2H3/t11-,12?,14?;;/m0../s1 |
| InChIKey | NZUXYXSMFWOXHJ-RRUCSRDBSA-N |
| XLogP | 2.22 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|