About 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine
1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine (PubChem CID 155735654) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine |
| PubChem CID | 155735654 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine |
| SMILES | [H]/N=C1C(=C/C)\C=C(C(=C)N(C)C)N\1C(CC)CCC |
| InChI | InChI=1S/C16H27N3/c1-7-10-14(9-3)19-15(12(4)18(5)6)11-13(8-2)16(19)17/h8,11,14,17H,4,7,9-10H2,1-3,5-6H3/b13-8-,17-16+ |
| InChIKey | QDRLUICGKMAJLH-PZLHKEIMSA-N |
| XLogP | 3.76 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine?
The IUPAC name of 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine (CID 155735654) is 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine.
What is the SMILES notation for 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine?
The canonical SMILES for 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine is [H]/N=C1C(=C/C)\C=C(C(=C)N(C)C)N\1C(CC)CCC.
What is the InChIKey of 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine?
The InChIKey is QDRLUICGKMAJLH-PZLHKEIMSA-N. The full InChI is InChI=1S/C16H27N3/c1-7-10-14(9-3)19-15(12(4)18(5)6)11-13(8-2)16(19)17/h8,11,14,17H,4,7,9-10H2,1-3,5-6H3/b13-8-,17-16+.
What are the key properties of 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine?
1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine has a molecular weight of 261.41 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-4-ethylidene-1-hexan-3-yl-5-iminopyrrol-2-yl]-N,N-dimethylethenamine is sourced from PubChem (CID 155735654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).