C23H33FN4S — CID 155735770
N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]prop-2-en-1-amine (PubChem CID 155735770) has the molecular formula C23H33FN4S and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 155735770 |
| Molecular Formula | C23H33FN4S |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCC1CC2=C(C(/C=C\CC(C)F)=N/C)CN=C(C(=C)S/C=C\C)N2C1 |
| InChI | InChI=1S/C23H33FN4S/c1-6-11-26-14-19-13-22-20(21(25-5)10-8-9-17(3)24)15-27-23(28(22)16-19)18(4)29-12-7-2/h6-8,10,12,17,19,26H,1,4,9,11,13-16H2,2-3,5H3/b10-8-,12-7-,25-21+ |
| InChIKey | ACDIXYXQZHKZSW-MYFRDHJISA-N |
| XLogP | 4.91 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|