C21H29FN4S — CID 155735830
(Z)-3-[[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methylimino]prop-1-en-1-amine (PubChem CID 155735830) has the molecular formula C21H29FN4S and a molecular weight of 388.56 g/mol. Its IUPAC name is (Z)-3-[[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methylimino]prop-1-en-1-amine.
| Compound Name | (Z)-3-[[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methylimino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 155735830 |
| Molecular Formula | C21H29FN4S |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (Z)-3-[[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methylimino]prop-1-en-1-amine |
| SMILES | C=C(/C=C\CC(C)F)C1=C2CC(C/N=C/C=C\N)CN2C(C(=C)SC)=NC1 |
| InChI | InChI=1S/C21H29FN4S/c1-15(7-5-8-16(2)22)19-13-25-21(17(3)27-4)26-14-18(11-20(19)26)12-24-10-6-9-23/h5-7,9-10,16,18H,1,3,8,11-14,23H2,2,4H3/b7-5-,9-6-,24-10+ |
| InChIKey | NYCUTBFAGQRGAZ-WIAQGCSNSA-N |
| XLogP | 4.25 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|