C6H8N2O4 — CID 155736518
2-[[(Z)-3-formamidoprop-2-enoyl]amino]acetic acid (PubChem CID 155736518) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 2-[[(Z)-3-formamidoprop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-3-formamidoprop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 155736518 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-[[(Z)-3-formamidoprop-2-enoyl]amino]acetic acid |
| SMILES | O=CN/C=C\C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H8N2O4/c9-4-7-2-1-5(10)8-3-6(11)12/h1-2,4H,3H2,(H,7,9)(H,8,10)(H,11,12)/b2-1- |
| InChIKey | KMMFQZHMHLMDGQ-UPHRSURJSA-N |
| XLogP | -1.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|