C7F10 — CID 15573718
1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]hept-2-ene (PubChem CID 15573718) has the molecular formula C7F10 and a molecular weight of 274.06 g/mol. Its IUPAC name is 1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 15573718 |
| Molecular Formula | C7F10 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]hept-2-ene |
| SMILES | FC1=C(F)C2(F)C(F)(F)C(F)(F)C1(F)C2(F)F |
| InChI | InChI=1S/C7F10/c8-1-2(9)4(11)5(12,13)3(1,10)6(14,15)7(4,16)17 |
| InChIKey | JIUPHDOASPDSEF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|