C16H11ClFN3O5 — CID 155737891
2-(4-chloro-2-fluoro-3-hydroxyphenyl)-1-[2-(hydroxyamino)-2-oxoethyl]benzimidazole-4-carboxylic acid (PubChem CID 155737891) has the molecular formula C16H11ClFN3O5 and a molecular weight of 379.73 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-3-hydroxyphenyl)-1-[2-(hydroxyamino)-2-oxoethyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-(4-chloro-2-fluoro-3-hydroxyphenyl)-1-[2-(hydroxyamino)-2-oxoethyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155737891 |
| Molecular Formula | C16H11ClFN3O5 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-(4-chloro-2-fluoro-3-hydroxyphenyl)-1-[2-(hydroxyamino)-2-oxoethyl]benzimidazole-4-carboxylic acid |
| SMILES | O=C(Cn1c(-c2ccc(Cl)c(O)c2F)nc2c(C(=O)O)cccc21)NO |
| InChI | InChI=1S/C16H11ClFN3O5/c17-9-5-4-7(12(18)14(9)23)15-19-13-8(16(24)25)2-1-3-10(13)21(15)6-11(22)20-26/h1-5,23,26H,6H2,(H,20,22)(H,24,25) |
| InChIKey | HZAPZMCUNNFJIX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|