C8H9N3OS — CID 155738169
3-pyrimidin-4-ylazetidine-1-carbothioic S-acid (PubChem CID 155738169) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-pyrimidin-4-ylazetidine-1-carbothioic S-acid.
| Compound Name | 3-pyrimidin-4-ylazetidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 155738169 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-pyrimidin-4-ylazetidine-1-carbothioic S-acid |
| SMILES | O=C(S)N1CC(c2ccncn2)C1 |
| InChI | InChI=1S/C8H9N3OS/c12-8(13)11-3-6(4-11)7-1-2-9-5-10-7/h1-2,5-6H,3-4H2,(H,12,13) |
| InChIKey | BCSGHETVSDQTDG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|