About 2-ethylhexyl 6-sulfanylhexanoate
2-ethylhexyl 6-sulfanylhexanoate (PubChem CID 155738868) has the molecular formula C14H28O2S
and a molecular weight of 260.44 g/mol. Its IUPAC name is 2-ethylhexyl 6-sulfanylhexanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 6-sulfanylhexanoate |
| PubChem CID | 155738868 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-ethylhexyl 6-sulfanylhexanoate |
| SMILES | CCCCC(CC)COC(=O)CCCCCS |
| InChI | InChI=1S/C14H28O2S/c1-3-5-9-13(4-2)12-16-14(15)10-7-6-8-11-17/h13,17H,3-12H2,1-2H3 |
| InChIKey | QRVXSSLZDDTAFA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 6-sulfanylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 6-sulfanylhexanoate?
The IUPAC name of 2-ethylhexyl 6-sulfanylhexanoate (CID 155738868) is 2-ethylhexyl 6-sulfanylhexanoate.
What is the SMILES notation for 2-ethylhexyl 6-sulfanylhexanoate?
The canonical SMILES for 2-ethylhexyl 6-sulfanylhexanoate is CCCCC(CC)COC(=O)CCCCCS.
What is the InChIKey of 2-ethylhexyl 6-sulfanylhexanoate?
The InChIKey is QRVXSSLZDDTAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2S/c1-3-5-9-13(4-2)12-16-14(15)10-7-6-8-11-17/h13,17H,3-12H2,1-2H3.
What are the key properties of 2-ethylhexyl 6-sulfanylhexanoate?
2-ethylhexyl 6-sulfanylhexanoate has a molecular weight of 260.44 g/mol, XLogP of 4.24, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 6-sulfanylhexanoate is sourced from PubChem (CID 155738868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).