About CID 155738994
CID 155738994 (PubChem CID 155738994) has the molecular formula C22H21BN4O2
and a molecular weight of 384.25 g/mol.
Molecular Properties
| Compound Name | CID 155738994 |
| PubChem CID | 155738994 |
| Molecular Formula | C22H21BN4O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2nc(C(C)c3ccc4c(c3)CCCN4C(=C=O)OC3CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H21BN4O2/c1-13(21-25-18-10-16(23)11-24-22(18)26-21)14-4-7-19-15(9-14)3-2-8-27(19)20(12-28)29-17-5-6-17/h4,7,9-11,13,17H,2-3,5-6,8H2,1H3,(H,24,25,26) |
| InChIKey | CUOAXBRPPJBQKR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze CID 155738994 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155738994?
The IUPAC name of CID 155738994 (CID 155738994) is not available.
What is the SMILES notation for CID 155738994?
The canonical SMILES for CID 155738994 is [B]c1cnc2nc(C(C)c3ccc4c(c3)CCCN4C(=C=O)OC3CC3)[nH]c2c1.
What is the InChIKey of CID 155738994?
The InChIKey is CUOAXBRPPJBQKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BN4O2/c1-13(21-25-18-10-16(23)11-24-22(18)26-21)14-4-7-19-15(9-14)3-2-8-27(19)20(12-28)29-17-5-6-17/h4,7,9-11,13,17H,2-3,5-6,8H2,1H3,(H,24,25,26).
What are the key properties of CID 155738994?
CID 155738994 has a molecular weight of 384.25 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155738994 is sourced from PubChem (CID 155738994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).