C22H21BN4O2 — CID 155738994
CID 155738994 (PubChem CID 155738994) has the molecular formula C22H21BN4O2 and a molecular weight of 384.25 g/mol.
| Compound Name | CID 155738994 |
|---|---|
| PubChem CID | 155738994 |
| Molecular Formula | C22H21BN4O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2nc(C(C)c3ccc4c(c3)CCCN4C(=C=O)OC3CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H21BN4O2/c1-13(21-25-18-10-16(23)11-24-22(18)26-21)14-4-7-19-15(9-14)3-2-8-27(19)20(12-28)29-17-5-6-17/h4,7,9-11,13,17H,2-3,5-6,8H2,1H3,(H,24,25,26) |
| InChIKey | CUOAXBRPPJBQKR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|