About ethyl 4-phenylsulfanylbenzoate
ethyl 4-phenylsulfanylbenzoate (PubChem CID 15573904) has the molecular formula C15H14O2S
and a molecular weight of 258.34 g/mol. Its IUPAC name is ethyl 4-phenylsulfanylbenzoate.
Molecular Properties
| Compound Name | ethyl 4-phenylsulfanylbenzoate |
| PubChem CID | 15573904 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | ethyl 4-phenylsulfanylbenzoate |
| SMILES | CCOC(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14O2S/c1-2-17-15(16)12-8-10-14(11-9-12)18-13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | MWWSTEHPUCOQQV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-phenylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-phenylsulfanylbenzoate?
The IUPAC name of ethyl 4-phenylsulfanylbenzoate (CID 15573904) is ethyl 4-phenylsulfanylbenzoate.
What is the SMILES notation for ethyl 4-phenylsulfanylbenzoate?
The canonical SMILES for ethyl 4-phenylsulfanylbenzoate is CCOC(=O)c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of ethyl 4-phenylsulfanylbenzoate?
The InChIKey is MWWSTEHPUCOQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2S/c1-2-17-15(16)12-8-10-14(11-9-12)18-13-6-4-3-5-7-13/h3-11H,2H2,1H3.
What are the key properties of ethyl 4-phenylsulfanylbenzoate?
ethyl 4-phenylsulfanylbenzoate has a molecular weight of 258.34 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-phenylsulfanylbenzoate is sourced from PubChem (CID 15573904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).