C27H48N4O — CID 155740126
2-methyl-8-[4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidin-1-yl]octan-4-one (PubChem CID 155740126) has the molecular formula C27H48N4O and a molecular weight of 444.71 g/mol. Its IUPAC name is 2-methyl-8-[4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidin-1-yl]octan-4-one.
| Compound Name | 2-methyl-8-[4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidin-1-yl]octan-4-one |
|---|---|
| PubChem CID | 155740126 |
| Molecular Formula | C27H48N4O |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | 2-methyl-8-[4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidin-1-yl]octan-4-one |
| SMILES | CC(C)CC(=O)CCCCN1CCC(CN2CCC(Cn3cc(C(C)C)cn3)CC2)CC1 |
| InChI | InChI=1S/C27H48N4O/c1-22(2)17-27(32)7-5-6-12-29-13-8-24(9-14-29)19-30-15-10-25(11-16-30)20-31-21-26(18-28-31)23(3)4/h18,21-25H,5-17,19-20H2,1-4H3 |
| InChIKey | HJLRGLOVSHZQJU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|