C21H29N3O4S — CID 155740786
[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]phenyl]-[2-[(2S)-1-methylpyrrolidin-2-yl]-1,3-thiazol-4-yl]methanone (PubChem CID 155740786) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is [3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]phenyl]-[2-[(2S)-1-methylpyrrolidin-2-yl]-1,3-thiazol-4-yl]methanone.
| Compound Name | [3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]phenyl]-[2-[(2S)-1-methylpyrrolidin-2-yl]-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 155740786 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]phenyl]-[2-[(2S)-1-methylpyrrolidin-2-yl]-1,3-thiazol-4-yl]methanone |
| SMILES | CN1CCC[C@H]1c1nc(C(=O)c2cccc(OCCOCCOCCN)c2)cs1 |
| InChI | InChI=1S/C21H29N3O4S/c1-24-8-3-6-19(24)21-23-18(15-29-21)20(25)16-4-2-5-17(14-16)28-13-12-27-11-10-26-9-7-22/h2,4-5,14-15,19H,3,6-13,22H2,1H3/t19-/m0/s1 |
| InChIKey | JCKNJMVREGEPOV-IBGZPJMESA-N |
| XLogP | 2.51 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|