About 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane
1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane (PubChem CID 155741160) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane |
| PubChem CID | 155741160 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane |
| SMILES | CC(C)CN1CCC(O)CC1.CCCC1CCC1 |
| InChI | InChI=1S/C9H19NO.C7H14/c1-8(2)7-10-5-3-9(11)4-6-10;1-2-4-7-5-3-6-7/h8-9,11H,3-7H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | LLNXDSNPCHBIDL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane?
The IUPAC name of 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane (CID 155741160) is 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane.
What is the SMILES notation for 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane?
The canonical SMILES for 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane is CC(C)CN1CCC(O)CC1.CCCC1CCC1.
What is the InChIKey of 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane?
The InChIKey is LLNXDSNPCHBIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C7H14/c1-8(2)7-10-5-3-9(11)4-6-10;1-2-4-7-5-3-6-7/h8-9,11H,3-7H2,1-2H3;7H,2-6H2,1H3.
What are the key properties of 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane?
1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane has a molecular weight of 255.45 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)piperidin-4-ol;propylcyclobutane is sourced from PubChem (CID 155741160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).