C24H28FN2O3+ — CID 155741826
[(3S,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl] (1S)-1-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate (PubChem CID 155741826) has the molecular formula C24H28FN2O3+ and a molecular weight of 411.50 g/mol. Its IUPAC name is [(3S,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl] (1S)-1-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate.
| Compound Name | [(3S,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl] (1S)-1-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate |
|---|---|
| PubChem CID | 155741826 |
| Molecular Formula | C24H28FN2O3+ |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | [(3S,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl] (1S)-1-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylate |
| SMILES | CN1C[C@H]2[C@@H](C1)OC[C@H]2OC(=O)[N+]1(C)CCc2ccccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN2O3/c1-26-13-20-21(14-26)29-15-22(20)30-24(28)27(2)12-11-16-5-3-4-6-19(16)23(27)17-7-9-18(25)10-8-17/h3-10,20-23H,11-15H2,1-2H3/q+1/t20-,21+,22+,23-,27?/m0/s1 |
| InChIKey | QANLWPZQGVYKMO-KCENYVAHSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|