C20H30N2O2 — CID 155741926
(2E)-1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methoxy-2-(4-propylpiperidin-3-ylidene)ethanone (PubChem CID 155741926) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2E)-1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methoxy-2-(4-propylpiperidin-3-ylidene)ethanone.
| Compound Name | (2E)-1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methoxy-2-(4-propylpiperidin-3-ylidene)ethanone |
|---|---|
| PubChem CID | 155741926 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (2E)-1-[4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methoxy-2-(4-propylpiperidin-3-ylidene)ethanone |
| SMILES | C=CC1=C(C=C)CN(C(=O)/C(OC)=C2\CNCCC2CCC)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-5-8-17-9-11-21-13-18(17)19(24-4)20(23)22-12-10-15(6-2)16(7-3)14-22/h6-7,17,21H,2-3,5,8-14H2,1,4H3/b19-18- |
| InChIKey | XDJIEXHJKZHLDX-HNENSFHCSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|