C16H28N2O — CID 155742019
3-[5-[(Z)-but-1-enyl]-4-methyl-1,2,3,6-tetrahydropyridin-6-yl]-5-(methylamino)pentanal (PubChem CID 155742019) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[5-[(Z)-but-1-enyl]-4-methyl-1,2,3,6-tetrahydropyridin-6-yl]-5-(methylamino)pentanal.
| Compound Name | 3-[5-[(Z)-but-1-enyl]-4-methyl-1,2,3,6-tetrahydropyridin-6-yl]-5-(methylamino)pentanal |
|---|---|
| PubChem CID | 155742019 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-[5-[(Z)-but-1-enyl]-4-methyl-1,2,3,6-tetrahydropyridin-6-yl]-5-(methylamino)pentanal |
| SMILES | CC/C=C\C1=C(C)CCNC1C(CC=O)CCNC |
| InChI | InChI=1S/C16H28N2O/c1-4-5-6-15-13(2)7-11-18-16(15)14(9-12-19)8-10-17-3/h5-6,12,14,16-18H,4,7-11H2,1-3H3/b6-5- |
| InChIKey | BHPFZUMIBQRXOA-WAYWQWQTSA-N |
| XLogP | 2.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|