About 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium
1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium (PubChem CID 155742081) has the molecular formula C19H20F2N2Y-2
and a molecular weight of 403.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium |
| PubChem CID | 155742081 |
| Molecular Formula | C19H20F2N2Y-2 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium |
| SMILES | C1CC[N-]C1.Fc1ccc(C2[N-]CCc3ccccc32)c(F)c1.[Y] |
| InChI | InChI=1S/C15H12F2N.C4H8N.Y/c16-11-5-6-13(14(17)9-11)15-12-4-2-1-3-10(12)7-8-18-15;1-2-4-5-3-1;/h1-6,9,15H,7-8H2;1-4H2;/q2*-1; |
| InChIKey | MECRUPUQVKZMGO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium?
The IUPAC name of 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium (CID 155742081) is 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium.
What is the SMILES notation for 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium?
The canonical SMILES for 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium is C1CC[N-]C1.Fc1ccc(C2[N-]CCc3ccccc32)c(F)c1.[Y].
What is the InChIKey of 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium?
The InChIKey is MECRUPUQVKZMGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N.C4H8N.Y/c16-11-5-6-13(14(17)9-11)15-12-4-2-1-3-10(12)7-8-18-15;1-2-4-5-3-1;/h1-6,9,15H,7-8H2;1-4H2;/q2*-1;.
What are the key properties of 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium?
1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium has a molecular weight of 403.29 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-3,4-dihydro-1H-isoquinolin-2-ide;pyrrolidin-1-ide;yttrium is sourced from PubChem (CID 155742081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).