C21H21F4NO5S — CID 155742137
tert-butyl (1S)-1-(4-fluorophenyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 155742137) has the molecular formula C21H21F4NO5S and a molecular weight of 475.46 g/mol. Its IUPAC name is tert-butyl (1S)-1-(4-fluorophenyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1S)-1-(4-fluorophenyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155742137 |
| Molecular Formula | C21H21F4NO5S |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | tert-butyl (1S)-1-(4-fluorophenyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F4NO5S/c1-20(2,3)30-19(27)26-11-10-13-6-9-16(31-32(28,29)21(23,24)25)12-17(13)18(26)14-4-7-15(22)8-5-14/h4-9,12,18H,10-11H2,1-3H3/t18-/m0/s1 |
| InChIKey | XJBOWOLZMMHAIO-SFHVURJKSA-N |
| XLogP | 4.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|