About 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide
2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide (PubChem CID 155742416) has the molecular formula C21H25N3O4
and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide.
Molecular Properties
| Compound Name | 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide |
| PubChem CID | 155742416 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide |
| SMILES | CCCOCc1ccc(NC=O)cc1.CNc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C11H15NO2.C10H10N2O2/c1-2-7-14-8-10-3-5-11(6-4-10)12-9-13;1-11-6-3-4-7-8(5-6)10(14)12(2)9(7)13/h3-6,9H,2,7-8H2,1H3,(H,12,13);3-5,11H,1-2H3 |
| InChIKey | TYNCMFXGIXMXLF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide?
The IUPAC name of 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide (CID 155742416) is 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide.
What is the SMILES notation for 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide?
The canonical SMILES for 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide is CCCOCc1ccc(NC=O)cc1.CNc1ccc2c(c1)C(=O)N(C)C2=O.
What is the InChIKey of 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide?
The InChIKey is TYNCMFXGIXMXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C10H10N2O2/c1-2-7-14-8-10-3-5-11(6-4-10)12-9-13;1-11-6-3-4-7-8(5-6)10(14)12(2)9(7)13/h3-6,9H,2,7-8H2,1H3,(H,12,13);3-5,11H,1-2H3.
What are the key properties of 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide?
2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide has a molecular weight of 383.45 g/mol, XLogP of 3.14, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(methylamino)isoindole-1,3-dione;N-[4-(propoxymethyl)phenyl]formamide is sourced from PubChem (CID 155742416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).